C16H20ClN3O3S2 — CID 112796459
2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-N-(4-methyl-3-sulfamoylphenyl)acetamide (PubChem CID 112796459) has the molecular formula C16H20ClN3O3S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-N-(4-methyl-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-N-(4-methyl-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 112796459 |
| Molecular Formula | C16H20ClN3O3S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-ethylamino]-N-(4-methyl-3-sulfamoylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(C)c(S(N)(=O)=O)c1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H20ClN3O3S2/c1-3-20(9-13-6-7-15(17)24-13)10-16(21)19-12-5-4-11(2)14(8-12)25(18,22)23/h4-8H,3,9-10H2,1-2H3,(H,19,21)(H2,18,22,23) |
| InChIKey | SJWPDPHABPTJHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |