C13H13ClN4O4S — CID 155804497
2-(5-chloro-6-oxopyridazin-1-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide (PubChem CID 155804497) has the molecular formula C13H13ClN4O4S and a molecular weight of 356.79 g/mol. Its IUPAC name is 2-(5-chloro-6-oxopyridazin-1-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(5-chloro-6-oxopyridazin-1-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 155804497 |
| Molecular Formula | C13H13ClN4O4S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-(5-chloro-6-oxopyridazin-1-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nccc(Cl)c2=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H13ClN4O4S/c1-8-2-3-9(6-11(8)23(15,21)22)17-12(19)7-18-13(20)10(14)4-5-16-18/h2-6H,7H2,1H3,(H,17,19)(H2,15,21,22) |
| InChIKey | SJCYOELGOMZSNG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |