C18H27BrO2 — CID 11279700
1-[[(E,6R)-8-bromo-6-methylnon-7-enoxy]methyl]-4-methoxybenzene (PubChem CID 11279700) has the molecular formula C18H27BrO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-[[(E,6R)-8-bromo-6-methylnon-7-enoxy]methyl]-4-methoxybenzene.
| Compound Name | 1-[[(E,6R)-8-bromo-6-methylnon-7-enoxy]methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 11279700 |
| Molecular Formula | C18H27BrO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[[(E,6R)-8-bromo-6-methylnon-7-enoxy]methyl]-4-methoxybenzene |
| SMILES | COc1ccc(COCCCCC[C@@H](C)/C=C(\C)Br)cc1 |
| InChI | InChI=1S/C18H27BrO2/c1-15(13-16(2)19)7-5-4-6-12-21-14-17-8-10-18(20-3)11-9-17/h8-11,13,15H,4-7,12,14H2,1-3H3/b16-13+/t15-/m1/s1 |
| InChIKey | GMKFUNADYQZCHL-WTNDLDAUSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|