C16H13ClN2O2S2 — CID 11280004
4-chloro-N-(2-methyl-5-phenyl-1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 11280004) has the molecular formula C16H13ClN2O2S2 and a molecular weight of 364.88 g/mol. Its IUPAC name is 4-chloro-N-(2-methyl-5-phenyl-1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-methyl-5-phenyl-1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11280004 |
| Molecular Formula | C16H13ClN2O2S2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 4-chloro-N-(2-methyl-5-phenyl-1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(Cl)cc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H13ClN2O2S2/c1-11-18-16(15(22-11)12-5-3-2-4-6-12)19-23(20,21)14-9-7-13(17)8-10-14/h2-10,19H,1H3 |
| InChIKey | JBMOMZGENPJCJV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |