C16H16F3N3O4 — CID 11280175
tert-butyl N-[(Z)-(1-cyclopropyl-6,7,8-trifluoro-2-oxo-3,1-benzoxazin-4-ylidene)amino]carbamate (PubChem CID 11280175) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(1-cyclopropyl-6,7,8-trifluoro-2-oxo-3,1-benzoxazin-4-ylidene)amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(1-cyclopropyl-6,7,8-trifluoro-2-oxo-3,1-benzoxazin-4-ylidene)amino]carbamate |
|---|---|
| PubChem CID | 11280175 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | tert-butyl N-[(Z)-(1-cyclopropyl-6,7,8-trifluoro-2-oxo-3,1-benzoxazin-4-ylidene)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=c1\oc(=O)n(C2CC2)c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C16H16F3N3O4/c1-16(2,3)26-14(23)21-20-13-8-6-9(17)10(18)11(19)12(8)22(7-4-5-7)15(24)25-13/h6-7H,4-5H2,1-3H3,(H,21,23)/b20-13- |
| InChIKey | AAKHUHOFIRKBKS-MOSHPQCFSA-N |
| XLogP | 2.69 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|