C27H32N4O3S — CID 112802302
2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylquinoline-4-carboxamide (PubChem CID 112802302) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylquinoline-4-carboxamide.
| Compound Name | 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 112802302 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylquinoline-4-carboxamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(c3cc(C(=O)NC4CC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O3S/c1-3-19(2)20-8-12-22(13-9-20)35(33,34)31-16-14-30(15-17-31)26-18-24(27(32)28-21-10-11-21)23-6-4-5-7-25(23)29-26/h4-9,12-13,18-19,21H,3,10-11,14-17H2,1-2H3,(H,28,32) |
| InChIKey | BTTCZOKYJMZGAG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |