C25H27N3O3 — CID 112802310
N-cyclopropyl-2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]quinoline-4-carboxamide (PubChem CID 112802310) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]quinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 112802310 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-cyclopropyl-2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]quinoline-4-carboxamide |
| SMILES | COc1ccc(OC)c(C2CCCN2c2cc(C(=O)NC3CC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-30-17-11-12-23(31-2)20(14-17)22-8-5-13-28(22)24-15-19(25(29)26-16-9-10-16)18-6-3-4-7-21(18)27-24/h3-4,6-7,11-12,14-16,22H,5,8-10,13H2,1-2H3,(H,26,29) |
| InChIKey | WDYLQJDFUOGIGH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |