C20H19ClN2O — CID 112803367
N,N-dibenzyl-4-chloro-1-methylpyrrole-2-carboxamide (PubChem CID 112803367) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is N,N-dibenzyl-4-chloro-1-methylpyrrole-2-carboxamide.
| Compound Name | N,N-dibenzyl-4-chloro-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 112803367 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N,N-dibenzyl-4-chloro-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Cl)cc1C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O/c1-22-15-18(21)12-19(22)20(24)23(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17/h2-12,15H,13-14H2,1H3 |
| InChIKey | FLQAQECIAOOZDC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |