C18H24ClN3O2 — CID 120649222
4-acetyl-N-(3-aminopropyl)-N-benzyl-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 120649222) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 4-acetyl-N-(3-aminopropyl)-N-benzyl-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-acetyl-N-(3-aminopropyl)-N-benzyl-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120649222 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-acetyl-N-(3-aminopropyl)-N-benzyl-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(=O)c1cc(C(=O)N(CCCN)Cc2ccccc2)n(C)c1.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-14(22)16-11-17(20(2)13-16)18(23)21(10-6-9-19)12-15-7-4-3-5-8-15;/h3-5,7-8,11,13H,6,9-10,12,19H2,1-2H3;1H |
| InChIKey | LLRJLGPRILQASB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |