C16H21BrClN3O — CID 120648433
N-(3-aminopropyl)-N-benzyl-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 120648433) has the molecular formula C16H21BrClN3O and a molecular weight of 386.72 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120648433 |
| Molecular Formula | C16H21BrClN3O |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(Br)cc1C(=O)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C16H20BrN3O.ClH/c1-19-12-14(17)10-15(19)16(21)20(9-5-8-18)11-13-6-3-2-4-7-13;/h2-4,6-7,10,12H,5,8-9,11,18H2,1H3;1H |
| InChIKey | HDFWDPVFOZDSGN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |