C20H24F2N2O4S — CID 112804277
1-(2,4-difluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]ethanamine (PubChem CID 112804277) has the molecular formula C20H24F2N2O4S and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]ethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 112804277 |
| Molecular Formula | C20H24F2N2O4S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]ethanamine |
| SMILES | CC(NCCOc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H24F2N2O4S/c1-15(19-7-2-16(21)14-20(19)22)23-8-11-28-17-3-5-18(6-4-17)29(25,26)24-9-12-27-13-10-24/h2-7,14-15,23H,8-13H2,1H3 |
| InChIKey | KARMZGAWWPWSQB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|