C22H26N2O4 — CID 11280506
methyl (1R,9R,12R,19S)-4,5-dimethoxy-8,16-diazahexacyclo[10.6.2.01,9.02,7.09,19.012,16]icosa-2,4,6,13-tetraene-8-carboxylate (PubChem CID 11280506) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (1R,9R,12R,19S)-4,5-dimethoxy-8,16-diazahexacyclo[10.6.2.01,9.02,7.09,19.012,16]icosa-2,4,6,13-tetraene-8-carboxylate.
| Compound Name | methyl (1R,9R,12R,19S)-4,5-dimethoxy-8,16-diazahexacyclo[10.6.2.01,9.02,7.09,19.012,16]icosa-2,4,6,13-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 11280506 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (1R,9R,12R,19S)-4,5-dimethoxy-8,16-diazahexacyclo[10.6.2.01,9.02,7.09,19.012,16]icosa-2,4,6,13-tetraene-8-carboxylate |
| SMILES | COC(=O)N1c2cc(OC)c(OC)cc2[C@]23CCN4CC=C[C@]45CC[C@]12[C@H]3C5 |
| InChI | InChI=1S/C22H26N2O4/c1-26-16-11-14-15(12-17(16)27-2)24(19(25)28-3)22-7-6-20-5-4-9-23(20)10-8-21(14,22)18(22)13-20/h4-5,11-12,18H,6-10,13H2,1-3H3/t18-,20+,21-,22+/m0/s1 |
| InChIKey | NDMUPHPUYWHOLZ-WSWWRLHASA-N |
| XLogP | 3.09 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|