C21H22N2O4 — CID 163061978
methyl 4-methoxy-13-oxo-8,12-diazahexacyclo[14.3.1.01,9.02,7.09,19.012,16]icosa-2(7),3,5,14-tetraene-8-carboxylate (PubChem CID 163061978) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 4-methoxy-13-oxo-8,12-diazahexacyclo[14.3.1.01,9.02,7.09,19.012,16]icosa-2(7),3,5,14-tetraene-8-carboxylate.
| Compound Name | methyl 4-methoxy-13-oxo-8,12-diazahexacyclo[14.3.1.01,9.02,7.09,19.012,16]icosa-2(7),3,5,14-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 163061978 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl 4-methoxy-13-oxo-8,12-diazahexacyclo[14.3.1.01,9.02,7.09,19.012,16]icosa-2(7),3,5,14-tetraene-8-carboxylate |
| SMILES | COC(=O)N1c2ccc(OC)cc2C23CC45C=CC(=O)N4CCC12C3CC5 |
| InChI | InChI=1S/C21H22N2O4/c1-26-13-3-4-15-14(11-13)20-12-19-7-5-16(20)21(20,23(15)18(25)27-2)9-10-22(19)17(24)6-8-19/h3-4,6,8,11,16H,5,7,9-10,12H2,1-2H3 |
| InChIKey | SSPSJUOUNMQACS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |