C18H21NO4 — CID 135066592
methyl (1R,9R,10S)-9-ethyl-6-methoxy-12-oxo-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate (PubChem CID 135066592) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (1R,9R,10S)-9-ethyl-6-methoxy-12-oxo-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate.
| Compound Name | methyl (1R,9R,10S)-9-ethyl-6-methoxy-12-oxo-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate |
|---|---|
| PubChem CID | 135066592 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl (1R,9R,10S)-9-ethyl-6-methoxy-12-oxo-2-azatetracyclo[7.5.0.01,10.03,8]tetradeca-3(8),4,6-triene-2-carboxylate |
| SMILES | CC[C@@]12c3cc(OC)ccc3N(C(=O)OC)[C@@]13CCC(=O)C[C@@H]23 |
| InChI | InChI=1S/C18H21NO4/c1-4-17-13-10-12(22-2)5-6-14(13)19(16(21)23-3)18(17)8-7-11(20)9-15(17)18/h5-6,10,15H,4,7-9H2,1-3H3/t15-,17-,18+/m0/s1 |
| InChIKey | UKZGGZSQCXXMMH-RYQLBKOJSA-N |
| XLogP | 3.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |