C17H24N2O5 — CID 141198411
4-(2-amino-2-ethyl-6-methoxy-3,4-dihydroquinoline-1-carbonyl)oxybutanoic acid (PubChem CID 141198411) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-(2-amino-2-ethyl-6-methoxy-3,4-dihydroquinoline-1-carbonyl)oxybutanoic acid.
| Compound Name | 4-(2-amino-2-ethyl-6-methoxy-3,4-dihydroquinoline-1-carbonyl)oxybutanoic acid |
|---|---|
| PubChem CID | 141198411 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-(2-amino-2-ethyl-6-methoxy-3,4-dihydroquinoline-1-carbonyl)oxybutanoic acid |
| SMILES | CCC1(N)CCc2cc(OC)ccc2N1C(=O)OCCCC(=O)O |
| InChI | InChI=1S/C17H24N2O5/c1-3-17(18)9-8-12-11-13(23-2)6-7-14(12)19(17)16(22)24-10-4-5-15(20)21/h6-7,11H,3-5,8-10,18H2,1-2H3,(H,20,21) |
| InChIKey | KRQBHXKNBGEFQA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|