C21H29F3N2O4 — CID 141123933
(6-ethoxy-6-oxohexyl) 2-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate (PubChem CID 141123933) has the molecular formula C21H29F3N2O4 and a molecular weight of 430.47 g/mol. Its IUPAC name is (6-ethoxy-6-oxohexyl) 2-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | (6-ethoxy-6-oxohexyl) 2-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 141123933 |
| Molecular Formula | C21H29F3N2O4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (6-ethoxy-6-oxohexyl) 2-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)CCCCCOC(=O)N1c2ccc(C(F)(F)F)cc2CCC1(N)CC |
| InChI | InChI=1S/C21H29F3N2O4/c1-3-20(25)12-11-15-14-16(21(22,23)24)9-10-17(15)26(20)19(28)30-13-7-5-6-8-18(27)29-4-2/h9-10,14H,3-8,11-13,25H2,1-2H3 |
| InChIKey | XDWPRVJAIJGJSP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|