C34H39F6N5O7 — CID 150303747
6-[(2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxyhexanoic acid (PubChem CID 150303747) has the molecular formula C34H39F6N5O7 and a molecular weight of 743.70 g/mol. Its IUPAC name is 6-[(2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxyhexanoic acid.
| Compound Name | 6-[(2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 150303747 |
| Molecular Formula | C34H39F6N5O7 |
| Molecular Weight | 743.70 g/mol |
| Exact Mass | 743.28 |
| IUPAC Name | 6-[(2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxyhexanoic acid |
| SMILES | CC[C@]1(N)C[C@H](c2ncc(OCCOC)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2nc(OC)ccc2N1C(=O)OCCCCCC(=O)O |
| InChI | InChI=1S/C34H39F6N5O7/c1-4-32(41)18-23(29-25(9-10-27(44-29)50-3)45(32)31(48)52-11-7-5-6-8-28(46)47)30-42-19-26(51-13-12-49-2)24(43-30)16-20-14-21(33(35,36)37)17-22(15-20)34(38,39)40/h9-10,14-15,17,19,23H,4-8,11-13,16,18,41H2,1-3H3,(H,46,47)/t23-,32+/m0/s1 |
| InChIKey | GKDUAEJDNKEUPS-JPQMRUPTSA-N |
| XLogP | 6.72 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|