C34H41F6N5O7 — CID 160595898
(2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-carboxybutoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid;ethoxyethane (PubChem CID 160595898) has the molecular formula C34H41F6N5O7 and a molecular weight of 745.72 g/mol. Its IUPAC name is (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-carboxybutoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid;ethoxyethane.
| Compound Name | (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-carboxybutoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid;ethoxyethane |
|---|---|
| PubChem CID | 160595898 |
| Molecular Formula | C34H41F6N5O7 |
| Molecular Weight | 745.72 g/mol |
| Exact Mass | 745.29 |
| IUPAC Name | (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-carboxybutoxy)pyrimidin-2-yl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid;ethoxyethane |
| SMILES | CCOCC.CC[C@]1(N)C[C@H](c2ncc(OCCCCC(=O)O)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2nc(OC)ccc2N1C(=O)O |
| InChI | InChI=1S/C30H31F6N5O6.C4H10O/c1-3-28(37)14-19(25-21(41(28)27(44)45)7-8-23(40-25)46-2)26-38-15-22(47-9-5-4-6-24(42)43)20(39-26)12-16-10-17(29(31,32)33)13-18(11-16)30(34,35)36;1-3-5-4-2/h7-8,10-11,13,15,19H,3-6,9,12,14,37H2,1-2H3,(H,42,43)(H,44,45);3-4H2,1-2H3/t19-,28+;/m0./s1 |
| InChIKey | RDPYTUGUZGIUKR-JDPQEGARSA-N |
| XLogP | 7.27 |
| TPSA | 170.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.72 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|