C34H38F6N4O7 — CID 154226685
5-[(2R,4S)-2-amino-4-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxypentanoic acid (PubChem CID 154226685) has the molecular formula C34H38F6N4O7 and a molecular weight of 728.69 g/mol. Its IUPAC name is 5-[(2R,4S)-2-amino-4-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxypentanoic acid.
| Compound Name | 5-[(2R,4S)-2-amino-4-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxypentanoic acid |
|---|---|
| PubChem CID | 154226685 |
| Molecular Formula | C34H38F6N4O7 |
| Molecular Weight | 728.69 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | 5-[(2R,4S)-2-amino-4-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]-2-ethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carbonyl]oxypentanoic acid |
| SMILES | CC[C@]1(N)C[C@@H](c2ncc(OCCOC)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nc(OC)ccc2N1C(=O)OCCCCC(=O)O |
| InChI | InChI=1S/C34H38F6N4O7/c1-4-32(41)18-25(30-26(8-9-27(43-30)49-3)44(32)31(47)51-10-6-5-7-28(45)46)29-21(16-24(19-42-29)50-12-11-48-2)13-20-14-22(33(35,36)37)17-23(15-20)34(38,39)40/h8-9,14-17,19,25H,4-7,10-13,18,41H2,1-3H3,(H,45,46)/t25-,32+/m0/s1 |
| InChIKey | FOBUAFLPOIQFRT-ZOYWYXQUSA-N |
| XLogP | 6.94 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|