C22H20N6O — CID 11280567
2-[5-(4-carbamimidoylphenyl)-2-methoxyphenyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 11280567) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[5-(4-carbamimidoylphenyl)-2-methoxyphenyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[5-(4-carbamimidoylphenyl)-2-methoxyphenyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 11280567 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[5-(4-carbamimidoylphenyl)-2-methoxyphenyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC)c(-c3nc4ccc(/C(N)=N/[H])cc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H20N6O/c1-29-19-9-7-14(12-2-4-13(5-3-12)20(23)24)10-16(19)22-27-17-8-6-15(21(25)26)11-18(17)28-22/h2-11H,1H3,(H3,23,24)(H3,25,26)(H,27,28) |
| InChIKey | BUTJJJVQJPVYLS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|