C18H17BrN4OS — CID 112807213
2-(4-bromo-2-methylphenyl)sulfanyl-N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)acetamide (PubChem CID 112807213) has the molecular formula C18H17BrN4OS and a molecular weight of 417.33 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 112807213 |
| Molecular Formula | C18H17BrN4OS |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(5-methyl-2-pyridin-2-ylpyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2ccc(Br)cc2C)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C18H17BrN4OS/c1-12-9-14(19)6-7-15(12)25-11-18(24)21-17-10-13(2)22-23(17)16-5-3-4-8-20-16/h3-10H,11H2,1-2H3,(H,21,24) |
| InChIKey | XOVRIELHQWFOSW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |