C12H20N2O6 — CID 11281081
(2S)-2-amino-5-[3-(diethylamino)-2,3-dioxopropoxy]-5-oxopentanoic acid (PubChem CID 11281081) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2S)-2-amino-5-[3-(diethylamino)-2,3-dioxopropoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[3-(diethylamino)-2,3-dioxopropoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11281081 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2S)-2-amino-5-[3-(diethylamino)-2,3-dioxopropoxy]-5-oxopentanoic acid |
| SMILES | CCN(CC)C(=O)C(=O)COC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H20N2O6/c1-3-14(4-2)11(17)9(15)7-20-10(16)6-5-8(13)12(18)19/h8H,3-7,13H2,1-2H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | KWURHBPZKBEQST-QMMMGPOBSA-N |
| XLogP | -0.84 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|