C10H19ClN2O7 — CID 11162833
(2S)-2-amino-5-(2,2-dimethyl-3-nitrooxypropoxy)-5-oxopentanoic acid;hydrochloride (PubChem CID 11162833) has the molecular formula C10H19ClN2O7 and a molecular weight of 314.72 g/mol. Its IUPAC name is (2S)-2-amino-5-(2,2-dimethyl-3-nitrooxypropoxy)-5-oxopentanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-5-(2,2-dimethyl-3-nitrooxypropoxy)-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 11162833 |
| Molecular Formula | C10H19ClN2O7 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2S)-2-amino-5-(2,2-dimethyl-3-nitrooxypropoxy)-5-oxopentanoic acid;hydrochloride |
| SMILES | CC(C)(COC(=O)CC[C@H](N)C(=O)O)CO[N+](=O)[O-].Cl |
| InChI | InChI=1S/C10H18N2O7.ClH/c1-10(2,6-19-12(16)17)5-18-8(13)4-3-7(11)9(14)15;/h7H,3-6,11H2,1-2H3,(H,14,15);1H/t7-;/m0./s1 |
| InChIKey | VRBGWFOWXYWRSP-FJXQXJEOSA-N |
| XLogP | 0.38 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|