C17H27N3O11S — CID 87695440
(2S)-2-amino-5-[[(2R)-3-[3-(2,2-dimethyl-3-nitrooxypropoxy)-2,3-dioxopropyl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87695440) has the molecular formula C17H27N3O11S and a molecular weight of 481.48 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-3-[3-(2,2-dimethyl-3-nitrooxypropoxy)-2,3-dioxopropyl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R)-3-[3-(2,2-dimethyl-3-nitrooxypropoxy)-2,3-dioxopropyl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87695440 |
| Molecular Formula | C17H27N3O11S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[3-(2,2-dimethyl-3-nitrooxypropoxy)-2,3-dioxopropyl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | COC(=O)[C@H](CSCC(=O)C(=O)OCC(C)(C)CO[N+](=O)[O-])NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C17H27N3O11S/c1-17(2,9-31-20(27)28)8-30-16(26)12(21)7-32-6-11(15(25)29-3)19-13(22)5-4-10(18)14(23)24/h10-11H,4-9,18H2,1-3H3,(H,19,22)(H,23,24)/t10-,11-/m0/s1 |
| InChIKey | JOZUWAIYUUYQPA-QWRGUYRKSA-N |
| XLogP | -1.08 |
| TPSA | 214.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|