C15H17N3O11S — CID 87695815
(2R)-2-amino-3-[3-[[3,5-bis(nitrooxymethyl)phenyl]methoxy]-2,3-dioxopropyl]sulfanylpropanoic acid (PubChem CID 87695815) has the molecular formula C15H17N3O11S and a molecular weight of 447.38 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-[[3,5-bis(nitrooxymethyl)phenyl]methoxy]-2,3-dioxopropyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[3-[[3,5-bis(nitrooxymethyl)phenyl]methoxy]-2,3-dioxopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87695815 |
| Molecular Formula | C15H17N3O11S |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (2R)-2-amino-3-[3-[[3,5-bis(nitrooxymethyl)phenyl]methoxy]-2,3-dioxopropyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSCC(=O)C(=O)OCc1cc(CO[N+](=O)[O-])cc(CO[N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C15H17N3O11S/c16-12(14(20)21)7-30-8-13(19)15(22)27-4-9-1-10(5-28-17(23)24)3-11(2-9)6-29-18(25)26/h1-3,12H,4-8,16H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | MKFPWMDOHXJDLG-LBPRGKRZSA-N |
| XLogP | -0.14 |
| TPSA | 211.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|