C10H14N4O13S — CID 87695523
(2R)-2-amino-3-[3-[2-nitro-3-nitrooxy-2-(nitrooxymethyl)propoxy]-2,3-dioxopropyl]sulfanylpropanoic acid (PubChem CID 87695523) has the molecular formula C10H14N4O13S and a molecular weight of 430.30 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-[2-nitro-3-nitrooxy-2-(nitrooxymethyl)propoxy]-2,3-dioxopropyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[3-[2-nitro-3-nitrooxy-2-(nitrooxymethyl)propoxy]-2,3-dioxopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87695523 |
| Molecular Formula | C10H14N4O13S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | (2R)-2-amino-3-[3-[2-nitro-3-nitrooxy-2-(nitrooxymethyl)propoxy]-2,3-dioxopropyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSCC(=O)C(=O)OCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H14N4O13S/c11-6(8(16)17)1-28-2-7(15)9(18)25-3-10(12(19)20,4-26-13(21)22)5-27-14(23)24/h6H,1-5,11H2,(H,16,17)/t6-/m0/s1 |
| InChIKey | WXKWOFBSHSBIDF-LURJTMIESA-N |
| XLogP | -2.32 |
| TPSA | 254.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|