C15H24N4O9S — CID 87712961
2-amino-5-[[1-[carboxy(methyl)amino]-3-[(2E)-3-ethoxy-2-hydroxyimino-3-oxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87712961) has the molecular formula C15H24N4O9S and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-amino-5-[[1-[carboxy(methyl)amino]-3-[(2E)-3-ethoxy-2-hydroxyimino-3-oxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[carboxy(methyl)amino]-3-[(2E)-3-ethoxy-2-hydroxyimino-3-oxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87712961 |
| Molecular Formula | C15H24N4O9S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-amino-5-[[1-[carboxy(methyl)amino]-3-[(2E)-3-ethoxy-2-hydroxyimino-3-oxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)/C(CSCC(NC(=O)CCC(N)C(=O)O)C(=O)N(C)C(=O)O)=N\O |
| InChI | InChI=1S/C15H24N4O9S/c1-3-28-14(24)10(18-27)7-29-6-9(12(21)19(2)15(25)26)17-11(20)5-4-8(16)13(22)23/h8-9,27H,3-7,16H2,1-2H3,(H,17,20)(H,22,23)(H,25,26)/b18-10- |
| InChIKey | GDBXYXSZFMZHOW-ZDLGFXPLSA-N |
| XLogP | -1.07 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|