C9H16N2O8 — CID 143025545
2-amino-5-[2-(hydroxymethyl)-3-nitrooxypropoxy]-5-oxopentanoic acid (PubChem CID 143025545) has the molecular formula C9H16N2O8 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-amino-5-[2-(hydroxymethyl)-3-nitrooxypropoxy]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[2-(hydroxymethyl)-3-nitrooxypropoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143025545 |
| Molecular Formula | C9H16N2O8 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-amino-5-[2-(hydroxymethyl)-3-nitrooxypropoxy]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)OCC(CO)CO[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H16N2O8/c10-7(9(14)15)1-2-8(13)18-4-6(3-12)5-19-11(16)17/h6-7,12H,1-5,10H2,(H,14,15) |
| InChIKey | CJZGKNZXWGNVOM-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|