C5H11NO6Si — CID 175519244
(2S)-2-amino-5-dihydroxysilyloxy-5-oxopentanoic acid (PubChem CID 175519244) has the molecular formula C5H11NO6Si and a molecular weight of 209.23 g/mol. Its IUPAC name is (2S)-2-amino-5-dihydroxysilyloxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-dihydroxysilyloxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175519244 |
| Molecular Formula | C5H11NO6Si |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | (2S)-2-amino-5-dihydroxysilyloxy-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)O[SiH](O)O)C(=O)O |
| InChI | InChI=1S/C5H11NO6Si/c6-3(5(8)9)1-2-4(7)12-13(10)11/h3,10-11,13H,1-2,6H2,(H,8,9)/t3-/m0/s1 |
| InChIKey | PPGXOFRGWYFBQY-VKHMYHEASA-N |
| XLogP | -2.58 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|