C12H18N4O12 — CID 11235239
(2S)-2-amino-5-[3-nitrooxy-2-(nitrooxymethyl)-2-(2-oxopropanoylamino)propoxy]-5-oxopentanoic acid (PubChem CID 11235239) has the molecular formula C12H18N4O12 and a molecular weight of 410.29 g/mol. Its IUPAC name is (2S)-2-amino-5-[3-nitrooxy-2-(nitrooxymethyl)-2-(2-oxopropanoylamino)propoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[3-nitrooxy-2-(nitrooxymethyl)-2-(2-oxopropanoylamino)propoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11235239 |
| Molecular Formula | C12H18N4O12 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2S)-2-amino-5-[3-nitrooxy-2-(nitrooxymethyl)-2-(2-oxopropanoylamino)propoxy]-5-oxopentanoic acid |
| SMILES | CC(=O)C(=O)NC(COC(=O)CC[C@H](N)C(=O)O)(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O12/c1-7(17)10(19)14-12(5-27-15(22)23,6-28-16(24)25)4-26-9(18)3-2-8(13)11(20)21/h8H,2-6,13H2,1H3,(H,14,19)(H,20,21)/t8-/m0/s1 |
| InChIKey | FGBMLHHOLGDJIP-QMMMGPOBSA-N |
| XLogP | -2.42 |
| TPSA | 240.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|