C22H25N3O3S — CID 112812647
N,8-dimethyl-N-[(2-morpholin-4-ylphenyl)methyl]quinoline-5-sulfonamide (PubChem CID 112812647) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N,8-dimethyl-N-[(2-morpholin-4-ylphenyl)methyl]quinoline-5-sulfonamide.
| Compound Name | N,8-dimethyl-N-[(2-morpholin-4-ylphenyl)methyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 112812647 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N,8-dimethyl-N-[(2-morpholin-4-ylphenyl)methyl]quinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccccc2N2CCOCC2)c2cccnc12 |
| InChI | InChI=1S/C22H25N3O3S/c1-17-9-10-21(19-7-5-11-23-22(17)19)29(26,27)24(2)16-18-6-3-4-8-20(18)25-12-14-28-15-13-25/h3-11H,12-16H2,1-2H3 |
| InChIKey | MBDGGWNXYOYIFE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |