C15H12ClF3N2O2S — CID 112815696
2-[(5-chloro-2-pyridinyl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 112815696) has the molecular formula C15H12ClF3N2O2S and a molecular weight of 376.79 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 112815696 |
| Molecular Formula | C15H12ClF3N2O2S |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | CC(Sc1ccc(Cl)cn1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12ClF3N2O2S/c1-9(24-13-7-2-10(16)8-20-13)14(22)21-11-3-5-12(6-4-11)23-15(17,18)19/h2-9H,1H3,(H,21,22) |
| InChIKey | SIFVRYLIYUMVSH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |