C19H23Cl3N2O3 — CID 112821184
3-cyclopentyl-1-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]propan-1-one (PubChem CID 112821184) has the molecular formula C19H23Cl3N2O3 and a molecular weight of 433.76 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 112821184 |
| Molecular Formula | C19H23Cl3N2O3 |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 3-cyclopentyl-1-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCC1CCCC1)N1CCN(C(=O)c2c(O)c(Cl)cc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C19H23Cl3N2O3/c20-13-11-14(21)18(26)16(17(13)22)19(27)24-9-7-23(8-10-24)15(25)6-5-12-3-1-2-4-12/h11-12,26H,1-10H2 |
| InChIKey | ZWRURUDRPYPYRR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|