C23H23Cl2N3O3 — CID 112821649
(1-benzoylpyrrolidin-2-yl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone (PubChem CID 112821649) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is (1-benzoylpyrrolidin-2-yl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | (1-benzoylpyrrolidin-2-yl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112821649 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (1-benzoylpyrrolidin-2-yl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCN(C(=O)C2CCCN2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c24-17-8-9-18(19(25)15-17)22(30)26-11-13-27(14-12-26)23(31)20-7-4-10-28(20)21(29)16-5-2-1-3-6-16/h1-3,5-6,8-9,15,20H,4,7,10-14H2 |
| InChIKey | AVDIKPYZMBKPEE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |