C23H30ClN3O3 — CID 55730027
[2-[4-(4-chlorobenzoyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-cyclohexylmethanone (PubChem CID 55730027) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is [2-[4-(4-chlorobenzoyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-cyclohexylmethanone.
| Compound Name | [2-[4-(4-chlorobenzoyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 55730027 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | [2-[4-(4-chlorobenzoyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN(C(=O)C2CCCN2C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H30ClN3O3/c24-19-10-8-18(9-11-19)21(28)25-13-15-26(16-14-25)23(30)20-7-4-12-27(20)22(29)17-5-2-1-3-6-17/h8-11,17,20H,1-7,12-16H2 |
| InChIKey | VYSQWCXUKNPQAJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |