C27H40O5 — CID 11282222
(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one (PubChem CID 11282222) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one.
| Compound Name | (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one |
|---|---|
| PubChem CID | 11282222 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one |
| SMILES | C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC(=O)[C@]23C)O[C@]12CC[C@@H](CO)CO2 |
| InChI | InChI=1S/C27H40O5/c1-15-24-22(32-27(15)9-6-16(13-28)14-31-27)11-21-19-5-4-17-10-18(29)7-8-25(17,2)20(19)12-23(30)26(21,24)3/h4,15-16,18-22,24,28-29H,5-14H2,1-3H3/t15-,16-,18-,19+,20-,21-,22-,24-,25-,26+,27+/m0/s1 |
| InChIKey | JHRYQGXOIWFJGK-FOWCCNIQSA-N |
| XLogP | 3.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|