C24H19ClN4OS — CID 11282274
2-[[1-(4-chlorophenyl)-5-(2-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-1H-benzimidazole (PubChem CID 11282274) has the molecular formula C24H19ClN4OS and a molecular weight of 446.96 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-5-(2-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-1H-benzimidazole.
| Compound Name | 2-[[1-(4-chlorophenyl)-5-(2-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11282274 |
| Molecular Formula | C24H19ClN4OS |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-5-(2-methoxyphenyl)imidazol-2-yl]sulfanylmethyl]-1H-benzimidazole |
| SMILES | COc1ccccc1-c1cnc(SCc2nc3ccccc3[nH]2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN4OS/c1-30-22-9-5-2-6-18(22)21-14-26-24(29(21)17-12-10-16(25)11-13-17)31-15-23-27-19-7-3-4-8-20(19)28-23/h2-14H,15H2,1H3,(H,27,28) |
| InChIKey | RGCAMKNRFNHBCR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |