C22H24BrClN2O — CID 11282299
(E)-3-(4-bromophenyl)-1-[(2R,5S)-4-[(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 11282299) has the molecular formula C22H24BrClN2O and a molecular weight of 447.80 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-1-[(2R,5S)-4-[(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromophenyl)-1-[(2R,5S)-4-[(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11282299 |
| Molecular Formula | C22H24BrClN2O |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (E)-3-(4-bromophenyl)-1-[(2R,5S)-4-[(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C[C@@H]1CN(Cc2ccc(Cl)cc2)[C@@H](C)CN1C(=O)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrClN2O/c1-16-14-26(22(27)12-7-18-3-8-20(23)9-4-18)17(2)13-25(16)15-19-5-10-21(24)11-6-19/h3-12,16-17H,13-15H2,1-2H3/b12-7+/t16-,17+/m0/s1 |
| InChIKey | MTVJXQQTZOCTJH-SVWBTXMESA-N |
| XLogP | 5.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|