C23H26ClFN4O2 — CID 68537909
[5-chloro-2-[3-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea (PubChem CID 68537909) has the molecular formula C23H26ClFN4O2 and a molecular weight of 444.94 g/mol. Its IUPAC name is [5-chloro-2-[3-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea.
| Compound Name | [5-chloro-2-[3-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea |
|---|---|
| PubChem CID | 68537909 |
| Molecular Formula | C23H26ClFN4O2 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [5-chloro-2-[3-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea |
| SMILES | C[C@@H]1CN(C(=O)C=Cc2ccc(Cl)cc2NC(N)=O)[C@@H](C)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26ClFN4O2/c1-15-13-29(16(2)12-28(15)14-17-3-8-20(25)9-4-17)22(30)10-6-18-5-7-19(24)11-21(18)27-23(26)31/h3-11,15-16H,12-14H2,1-2H3,(H3,26,27,31)/t15-,16+/m1/s1 |
| InChIKey | SOQTZVDCTDWUPS-CVEARBPZSA-N |
| XLogP | 4.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|