C18H24N4O5S — CID 112828525
1-[3,5-dimethyl-1-[2-(3-nitrophenoxy)ethyl]pyrazol-4-yl]sulfonylpiperidine (PubChem CID 112828525) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[2-(3-nitrophenoxy)ethyl]pyrazol-4-yl]sulfonylpiperidine.
| Compound Name | 1-[3,5-dimethyl-1-[2-(3-nitrophenoxy)ethyl]pyrazol-4-yl]sulfonylpiperidine |
|---|---|
| PubChem CID | 112828525 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[3,5-dimethyl-1-[2-(3-nitrophenoxy)ethyl]pyrazol-4-yl]sulfonylpiperidine |
| SMILES | Cc1nn(CCOc2cccc([N+](=O)[O-])c2)c(C)c1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H24N4O5S/c1-14-18(28(25,26)20-9-4-3-5-10-20)15(2)21(19-14)11-12-27-17-8-6-7-16(13-17)22(23)24/h6-8,13H,3-5,9-12H2,1-2H3 |
| InChIKey | ISGAUSWYLWNJQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|