C17H22N4O6S2 — CID 46354022
1-[3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazol-4-yl]sulfonylazepane (PubChem CID 46354022) has the molecular formula C17H22N4O6S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazol-4-yl]sulfonylazepane.
| Compound Name | 1-[3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazol-4-yl]sulfonylazepane |
|---|---|
| PubChem CID | 46354022 |
| Molecular Formula | C17H22N4O6S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-[3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazol-4-yl]sulfonylazepane |
| SMILES | Cc1nn(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c(C)c1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C17H22N4O6S2/c1-13-17(29(26,27)19-10-5-3-4-6-11-19)14(2)20(18-13)28(24,25)16-9-7-8-15(12-16)21(22)23/h7-9,12H,3-6,10-11H2,1-2H3 |
| InChIKey | YVQLPBYNUFUORF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|