C17H16ClN3O3 — CID 112828951
N-(4-chloro-2-methoxy-5-methylphenyl)-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 112828951) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112828951 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cc(-c2ccc(C)o2)[nH]n1 |
| InChI | InChI=1S/C17H16ClN3O3/c1-9-6-12(16(23-3)7-11(9)18)19-17(22)14-8-13(20-21-14)15-5-4-10(2)24-15/h4-8H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | QHVOOKGAGNOHDT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |