C12H18ClNS — CID 112829058
N-[(3-chlorophenyl)methyl]-N-ethyl-2-methylsulfanylethanamine (PubChem CID 112829058) has the molecular formula C12H18ClNS and a molecular weight of 243.80 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-ethyl-2-methylsulfanylethanamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-ethyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 112829058 |
| Molecular Formula | C12H18ClNS |
| Molecular Weight | 243.80 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-ethyl-2-methylsulfanylethanamine |
| SMILES | CCN(CCSC)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNS/c1-3-14(7-8-15-2)10-11-5-4-6-12(13)9-11/h4-6,9H,3,7-8,10H2,1-2H3 |
| InChIKey | XXFPSIZQLRVGOV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |