C12H16ClN — CID 142098945
N-[(3-chlorophenyl)methyl]-N-ethylprop-2-en-1-amine (PubChem CID 142098945) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-ethylprop-2-en-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 142098945 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-ethylprop-2-en-1-amine |
| SMILES | C=CCN(CC)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClN/c1-3-8-14(4-2)10-11-6-5-7-12(13)9-11/h3,5-7,9H,1,4,8,10H2,2H3 |
| InChIKey | AFAUTZVAENQEEF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|