C20H16FN7OS2 — CID 112830224
12-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 112830224) has the molecular formula C20H16FN7OS2 and a molecular weight of 453.53 g/mol. Its IUPAC name is 12-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 112830224 |
| Molecular Formula | C20H16FN7OS2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 12-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | C=CCn1c(SCc2nnc3n(C)c(=O)c4sccc4n23)nnc1-c1ccccc1F |
| InChI | InChI=1S/C20H16FN7OS2/c1-3-9-27-17(12-6-4-5-7-13(12)21)23-25-20(27)31-11-15-22-24-19-26(2)18(29)16-14(28(15)19)8-10-30-16/h3-8,10H,1,9,11H2,2H3 |
| InChIKey | UHKQLEXIPWTHNM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|