C20H16N6O2S2 — CID 46479728
8-methyl-12-[(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 46479728) has the molecular formula C20H16N6O2S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 8-methyl-12-[(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-methyl-12-[(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 46479728 |
| Molecular Formula | C20H16N6O2S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 8-methyl-12-[(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | C=CCn1c(SCc2nnc3n(C)c(=O)c4sccc4n23)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H16N6O2S2/c1-3-9-25-17(27)12-6-4-5-7-13(12)21-20(25)30-11-15-22-23-19-24(2)18(28)16-14(26(15)19)8-10-29-16/h3-8,10H,1,9,11H2,2H3 |
| InChIKey | GELZPWVGFIYFDG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|