C27H28N4O4 — CID 112830791
3-methyl-N,N'-bis[4-(2-methyl-1,3-oxazol-5-yl)phenyl]hexanediamide (PubChem CID 112830791) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 3-methyl-N,N'-bis[4-(2-methyl-1,3-oxazol-5-yl)phenyl]hexanediamide.
| Compound Name | 3-methyl-N,N'-bis[4-(2-methyl-1,3-oxazol-5-yl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 112830791 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 3-methyl-N,N'-bis[4-(2-methyl-1,3-oxazol-5-yl)phenyl]hexanediamide |
| SMILES | Cc1ncc(-c2ccc(NC(=O)CCC(C)CC(=O)Nc3ccc(-c4cnc(C)o4)cc3)cc2)o1 |
| InChI | InChI=1S/C27H28N4O4/c1-17(14-27(33)31-23-11-7-21(8-12-23)25-16-29-19(3)35-25)4-13-26(32)30-22-9-5-20(6-10-22)24-15-28-18(2)34-24/h5-12,15-17H,4,13-14H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | GPMHTTZAISVCKR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |