C15H20ClN3O2 — CID 119704467
4-(methylamino)-N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]butanamide;hydrochloride (PubChem CID 119704467) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-(methylamino)-N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119704467 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-(methylamino)-N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1ccc(-c2cnc(C)o2)cc1.Cl |
| InChI | InChI=1S/C15H19N3O2.ClH/c1-11-17-10-14(20-11)12-5-7-13(8-6-12)18-15(19)4-3-9-16-2;/h5-8,10,16H,3-4,9H2,1-2H3,(H,18,19);1H |
| InChIKey | SZNQYBVBKQTLGY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|