C17H14F6N2O3 — CID 112830943
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(2-ethoxy-3-pyridinyl)acetamide (PubChem CID 112830943) has the molecular formula C17H14F6N2O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(2-ethoxy-3-pyridinyl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(2-ethoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 112830943 |
| Molecular Formula | C17H14F6N2O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(2-ethoxy-3-pyridinyl)acetamide |
| SMILES | CCOc1ncccc1NC(=O)COc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O3/c1-2-27-15-13(4-3-5-24-15)25-14(26)9-28-12-7-10(16(18,19)20)6-11(8-12)17(21,22)23/h3-8H,2,9H2,1H3,(H,25,26) |
| InChIKey | JFZQJLGWYVNLEB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |