C22H29N3O2 — CID 112832137
1-(2-adamantyl)-3-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]urea (PubChem CID 112832137) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]urea.
| Compound Name | 1-(2-adamantyl)-3-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 112832137 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-(2-adamantyl)-3-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1C2CC3CC(C2)CC1C3)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C22H29N3O2/c1-12(15-2-4-19-16(11-15)3-5-20(26)24-19)23-22(27)25-21-17-7-13-6-14(9-17)10-18(21)8-13/h2,4,11-14,17-18,21H,3,5-10H2,1H3,(H,24,26)(H2,23,25,27) |
| InChIKey | PBCQKWVBAIEMOQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |